Difference between revisions of "CPD0-1108"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-amp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite N-terminal-glycine == * common-name: ** an n-terminal glycyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-AMP ==
+
== Metabolite N-terminal-glycine ==
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-amp
+
** an n-terminal glycyl-[protein]
* smiles:
 
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 
* inchi-key:
 
** rtqmrtsptliihm-keohhstqsa-j
 
* molecular-weight:
 
** 555.288
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTCYCLOHYD-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTPRATPHYD-RXN]]
+
* [[RXN-17875]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-amp}}
+
{{#set: common-name=an n-terminal glycyl-[protein]}}
{{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}}
 
{{#set: molecular-weight=555.288}}
 

Revision as of 18:57, 14 January 2021

Metabolite N-terminal-glycine

  • common-name:
    • an n-terminal glycyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal glycyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.