Difference between revisions of "CPD-15425"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-ribulosamines == * common-name: ** a [protein]-n6-d-ribulosyl-l-lysine == Reaction(s) known to consume the compound == * RXN-12...") |
(Created page with "Category:metabolite == Metabolite CPD-10277 == * common-name: ** lotaustralin * smiles: ** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c * inchi-key: ** wewbwvmtoyuphh-qhaqebjbsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10277 == |
* common-name: | * common-name: | ||
| − | ** | + | ** lotaustralin |
| + | * smiles: | ||
| + | ** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c | ||
| + | * inchi-key: | ||
| + | ** wewbwvmtoyuphh-qhaqebjbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 261.274 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9674]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13603]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=lotaustralin}} |
| + | {{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}} | ||
| + | {{#set: molecular-weight=261.274}} | ||
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-10277
- common-name:
- lotaustralin
- smiles:
- ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
- inchi-key:
- wewbwvmtoyuphh-qhaqebjbsa-n
- molecular-weight:
- 261.274
