Difference between revisions of "5Z-3-oxo-tetradec-5-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...")
(Created page with "Category:metabolite == Metabolite Trans-D2-hexacos-2-enoyl-ACPs == * common-name: ** a trans-hexacos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11770 ==
+
== Metabolite Trans-D2-hexacos-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 7,8-dihydromonapterin
+
** a trans-hexacos-2-enoyl-[acp]
* smiles:
 
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
 
* inchi-key:
 
** yqifamynggotfb-njgyiypdsa-n
 
* molecular-weight:
 
** 255.233
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10857]]
+
* [[RXN-10062]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10061]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydromonapterin}}
+
{{#set: common-name=a trans-hexacos-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}}
 
{{#set: molecular-weight=255.233}}
 

Revision as of 18:57, 14 January 2021

Metabolite Trans-D2-hexacos-2-enoyl-ACPs

  • common-name:
    • a trans-hexacos-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-hexacos-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.