Difference between revisions of "1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYLNEURAMINATE == * common-name: ** n-acetylneuraminate == Reaction(s) known to consume the compound == * 2.3.1.45-RXN * RXN-7...") |
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11529 == |
* common-name: | * common-name: | ||
| − | ** n- | + | ** (+)-7-epi-jasmonoyl-coa |
| + | * smiles: | ||
| + | ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) | ||
| + | * inchi-key: | ||
| + | ** wqkkcppndksaiu-cbgydujusa-j | ||
| + | * molecular-weight: | ||
| + | ** 955.76 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10708]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10701]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-7-epi-jasmonoyl-coa}} |
| + | {{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}} | ||
| + | {{#set: molecular-weight=955.76}} | ||
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-11529
- common-name:
- (+)-7-epi-jasmonoyl-coa
- smiles:
- ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
- inchi-key:
- wqkkcppndksaiu-cbgydujusa-j
- molecular-weight:
- 955.76
