Difference between revisions of "1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aldehydes == * common-name: ** an aldehyde == Reaction(s) known to consume the compound == * ALCOHOL-DEHYDROG-GENERIC-RXN * ALCOHOL...") |
(Created page with "Category:metabolite == Metabolite CPD-444 == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) * inchi-key: *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-444 == |
* common-name: | * common-name: | ||
− | ** | + | ** s-(methyl-5-thio-α-d-ribose 1-phosphate |
+ | * smiles: | ||
+ | ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) | ||
+ | * inchi-key: | ||
+ | ** jtfittqbrjdstl-kvtdhhqdsa-l | ||
+ | * molecular-weight: | ||
+ | ** 258.182 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[5.3.1.23-RXN]] |
− | + | * [[M5TRPI]] | |
− | |||
− | |||
− | |||
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[M5TAP]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}} |
+ | {{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}} | ||
+ | {{#set: molecular-weight=258.182}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite CPD-444
- common-name:
- s-(methyl-5-thio-α-d-ribose 1-phosphate
- smiles:
- cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
- inchi-key:
- jtfittqbrjdstl-kvtdhhqdsa-l
- molecular-weight:
- 258.182