Difference between revisions of "1-3-beta-D-Glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Nucleotides == * common-name: ** a nucleotide == Reaction(s) known to consume the compound == * NUCLEOTIDASE-RXN == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite CPD-397 == * common-name: ** s-methyl-l-methionine * smiles: ** c[s+](ccc([n+])c(=o)[o-])c * inchi-key: ** ydbyjhtyshbbau-yfkpbyrvsa-o *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-397 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-methyl-l-methionine |
| + | * smiles: | ||
| + | ** c[s+](ccc([n+])c(=o)[o-])c | ||
| + | * inchi-key: | ||
| + | ** ydbyjhtyshbbau-yfkpbyrvsa-o | ||
| + | * molecular-weight: | ||
| + | ** 164.242 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MMUM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-methyl-l-methionine}} |
| + | {{#set: inchi-key=inchikey=ydbyjhtyshbbau-yfkpbyrvsa-o}} | ||
| + | {{#set: molecular-weight=164.242}} | ||
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-397
- common-name:
- s-methyl-l-methionine
- smiles:
- c[s+](ccc([n+])c(=o)[o-])c
- inchi-key:
- ydbyjhtyshbbau-yfkpbyrvsa-o
- molecular-weight:
- 164.242
