Difference between revisions of "1-4-D-xylooligosaccharides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12125 == * common-name: ** menaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(...")
(Created page with "Category:metabolite == Metabolite 12-EPOXYPROPANE == * common-name: ** 1,2-epoxypropane == Reaction(s) known to consume the compound == * RXN-17617 * RXN-17622 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12125 ==
+
== Metabolite 12-EPOXYPROPANE ==
 
* common-name:
 
* common-name:
** menaquinol-7
+
** 1,2-epoxypropane
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
 
* inchi-key:
 
** vfgnpjrrtkmykn-ljwnyqgcsa-n
 
* molecular-weight:
 
** 651.026
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17617]]
 +
* [[RXN-17622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9191]]
+
* [[RXN-17622]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-7}}
+
{{#set: common-name=1,2-epoxypropane}}
{{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}}
 
{{#set: molecular-weight=651.026}}
 

Revision as of 13:12, 14 January 2021

Metabolite 12-EPOXYPROPANE

  • common-name:
    • 1,2-epoxypropane

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality