Difference between revisions of "1-4-alpha-D-Glucan"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylguanine-26 == * common-name: ** an n2-methylguanine26 in trna == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11878 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxyphenylglycol |
| + | * smiles: | ||
| + | ** c(o)c(o)c1(c=cc(o)=c(o)c=1) | ||
| + | * inchi-key: | ||
| + | ** mtvwfvdwrvydor-qmmmgpobsa-n | ||
| + | * molecular-weight: | ||
| + | ** 170.165 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10911]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylglycol}} |
| + | {{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}} | ||
| + | {{#set: molecular-weight=170.165}} | ||
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-11878
- common-name:
- 3,4-dihydroxyphenylglycol
- smiles:
- c(o)c(o)c1(c=cc(o)=c(o)c=1)
- inchi-key:
- mtvwfvdwrvydor-qmmmgpobsa-n
- molecular-weight:
- 170.165
