Difference between revisions of "1-4-alpha-D-Glucan"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite 1-4-alpha-D-Glucan == * common-name: ** a 1,4-α-d-glucan == Reaction(s) known to consume the compound == * ALPHA-AMYL-RXN * M...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-4-alpha-D-Glucan == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1,4-α-d-glucan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ALPHA-AMYL-RXN]] | ||
| + | * [[MALTODEXGLUCOSID-RXN]] | ||
| + | * [[RXN0-5181]] | ||
| + | * [[RXN0-5184]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ALPHA-AMYL-RXN]] |
| + | * [[MALTODEXGLUCOSID-RXN]] | ||
| + | * [[RXN0-5181]] | ||
| + | * [[RXN0-5184]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1,4-α-d-glucan}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 1-4-alpha-D-Glucan
- common-name:
- a 1,4-α-d-glucan
