Difference between revisions of "1-4-beta-Xylan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00547 == * transcription-direction: ** positive * right-end-position: ** 25503 * left-end-position: ** 23467 * centisome-position: ** 14.179884...")
(Created page with "Category:metabolite == Metabolite CPD-11524 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(s...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00547 ==
+
== Metabolite CPD-11524 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
* right-end-position:
+
* smiles:
** 25503
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
* left-end-position:
+
* inchi-key:
** 23467
+
** adgirvmshggghu-azvxsvfwsa-j
* centisome-position:
+
* molecular-weight:
** 14.179884   
+
** 1025.85
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10700]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.2.1.1-RXN]]
+
* [[RXN-10702]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}}
* [[ALPHA-AMYL-RXN]]
+
{{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=1025.85}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-1823]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-1825]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5181]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=25503}}
 
{{#set: left-end-position=23467}}
 
{{#set: centisome-position=14.179884    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-11524

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • adgirvmshggghu-azvxsvfwsa-j
  • molecular-weight:
    • 1025.85

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality