Difference between revisions of "1-4-beta-Xylan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11524 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(s...")
(Created page with "Category:metabolite == Metabolite OHyW-tRNAPhe == * common-name: ** 2-hydroxy-wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11524 ==
+
== Metabolite OHyW-tRNAPhe ==
 
* common-name:
 
* common-name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
+
** 2-hydroxy-wybutosine37 in trnaphe
−
* smiles:
 
−
** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
−
* inchi-key:
 
−
** adgirvmshggghu-azvxsvfwsa-j
 
−
* molecular-weight:
 
−
** 1025.85
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10700]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10702]]
+
* [[RXN-14540]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}}
+
{{#set: common-name=2-hydroxy-wybutosine37 in trnaphe}}
−
{{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}}
 
−
{{#set: molecular-weight=1025.85}}
 

Revision as of 14:54, 5 January 2021

Metabolite OHyW-tRNAPhe

  • common-name:
    • 2-hydroxy-wybutosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-4-beta-Xylan&oldid=59042"