Difference between revisions of "1-6-beta-D-Glucan"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...") |
(Created page with "Category:metabolite == Metabolite 1-6-beta-D-Glucan == * common-name: ** a 1,6-β-d-glucan == Reaction(s) known to consume the compound == * 3.2.1.75-RXN == Reacti...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-6-beta-D-Glucan == |
* common-name: | * common-name: | ||
− | ** | + | ** a 1,6-β-d-glucan |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.2.1.75-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 1,6-β-d-glucan}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 1-6-beta-D-Glucan
- common-name:
- a 1,6-β-d-glucan