Difference between revisions of "1-7-DIMETHYLXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18617 == * transcription-direction: ** positive * right-end-position: ** 195285 * left-end-position: ** 191363 * centisome-position: ** 79.19441...") |
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * smiles: ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) * inchi-key: ** qunwudvfrngtco-uhff...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 1-7-DIMETHYLXANTHINE == |
− | * | + | * common-name: |
− | ** | + | ** paraxanthine |
− | * | + | * smiles: |
− | ** | + | ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) |
− | * | + | * inchi-key: |
− | ** | + | ** qunwudvfrngtco-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 180.166 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11520]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=paraxanthine}} | |
− | + | {{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}} | |
− | + | {{#set: molecular-weight=180.166}} | |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 1-7-DIMETHYLXANTHINE
- common-name:
- paraxanthine
- smiles:
- cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
- inchi-key:
- qunwudvfrngtco-uhfffaoysa-n
- molecular-weight:
- 180.166