Difference between revisions of "1-ACYL-2-LINOLEOYL-SN-GLYCERO-3-PHOSPHOC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Adenine57-Adenine58-tRNAs == * common-name: ** an adenine57/adenine58 in trna == Reaction(s) known to consume the compound == * RXN-124...") |
(Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-key: ** fuesbomyallfni-vkhmyheas...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13395 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-asparagine |
| + | * smiles: | ||
| + | ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** fuesbomyallfni-vkhmyheasa-n | ||
| + | * molecular-weight: | ||
| + | ** 189.171 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6982]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-asparagine}} |
| + | {{#set: inchi-key=inchikey=fuesbomyallfni-vkhmyheasa-n}} | ||
| + | {{#set: molecular-weight=189.171}} | ||
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-13395
- common-name:
- glycyl-l-asparagine
- smiles:
- c([n+])c(=o)nc(cc(n)=o)c([o-])=o
- inchi-key:
- fuesbomyallfni-vkhmyheasa-n
- molecular-weight:
- 189.171
