Difference between revisions of "1-ALKYL-GLYCERONE-3-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleyl-2-lyso-phosphatidate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-18539 == * common-name: ** (r)-n-formyl-β-hydroxy-l-kynurenine * smiles: ** [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-]) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-18539 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-n-formyl-β-hydroxy-l-kynurenine |
* smiles: | * smiles: | ||
| − | ** | + | ** [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gadduklgjyjxsl-wcbmzhexsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 252.226 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17150]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-n-formyl-β-hydroxy-l-kynurenine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gadduklgjyjxsl-wcbmzhexsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=252.226}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-18539
- common-name:
- (r)-n-formyl-β-hydroxy-l-kynurenine
- smiles:
- [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-])
- inchi-key:
- gadduklgjyjxsl-wcbmzhexsa-n
- molecular-weight:
- 252.226
