Difference between revisions of "1-Alkenylglycerophosphoethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
(Created page with "Category:metabolite == Metabolite 1-Alkenylglycerophosphoethanolamines == * common-name: ** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine == Reaction(s) known to con...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-Alkenylglycerophosphoethanolamines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17735]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 1-Alkenylglycerophosphoethanolamines
- common-name:
- a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine
