Difference between revisions of "1-Alkenylglycerophosphoethanolamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14553 == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)n...")
(Created page with "Category:metabolite == Metabolite CPD-17396 == * common-name: ** a [glycerolipid]-ricinoleate == Reaction(s) known to consume the compound == * RXN-16149 * RXN-16151...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14553 ==
+
== Metabolite CPD-17396 ==
 
* common-name:
 
* common-name:
** udp-α-d-galactose
+
** a [glycerolipid]-ricinoleate
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
* inchi-key:
 
** hscjrczfdfqwrp-abvwguqpsa-l
 
* molecular-weight:
 
** 564.289
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-16149]]
* [[2.4.1.122-RXN]]
+
* [[RXN-16151]]
* [[2.4.1.123-RXN]]
 
* [[2.4.1.134-RXN]]
 
* [[2.4.1.151-RXN]]
 
* [[2.4.1.38-RXN]]
 
* [[2.4.1.46-RXN]]
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[LACTOSE-SYNTHASE-RXN]]
 
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 
* [[RXN-1225]]
 
* [[RXN-14561]]
 
* [[RXN-15276]]
 
* [[RXN-15277]]
 
* [[RXN-15278]]
 
* [[RXN-16027]]
 
* [[RXN-18266]]
 
* [[RXN-18302]]
 
* [[UDPGALtg]]
 
* [[UDPGALth]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UG4E]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-16151]]
* [[RXN-16027]]
 
* [[UDPGALtg]]
 
* [[UDPGALth]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UG4E]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-galactose}}
+
{{#set: common-name=a [glycerolipid]-ricinoleate}}
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
 
{{#set: molecular-weight=564.289}}
 

Revision as of 15:27, 5 January 2021

Metabolite CPD-17396

  • common-name:
    • a [glycerolipid]-ricinoleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-ricinoleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.