Difference between revisions of "1-Alkenylglycerophosphoethanolamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-D-GALACTURONATE == * common-name: ** udp-α-d-galacturonate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite Angiotensinogens == * common-name: ** an angiotensinogen == Reaction(s) known to consume the compound == * 3.4.23.15-RXN == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-D-GALACTURONATE ==
+
== Metabolite Angiotensinogens ==
 
* common-name:
 
* common-name:
** udp-α-d-galacturonate
+
** an angiotensinogen
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
 
* inchi-key:
 
** hdyanyhvcapmjv-gxnrkqdosa-k
 
* molecular-weight:
 
** 577.265
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
* [[3.4.23.15-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-galacturonate}}
+
{{#set: common-name=an angiotensinogen}}
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-gxnrkqdosa-k}}
 
{{#set: molecular-weight=577.265}}
 

Revision as of 18:55, 14 January 2021

Metabolite Angiotensinogens

  • common-name:
    • an angiotensinogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality