Difference between revisions of "1-Alkyl-2-acyl-glycerol"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-arachidoyl-ACPs == * common-name: ** a 3-oxo-arachidoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-349 == Re...") |
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-170 == |
* common-name: | * common-name: | ||
− | ** | + | ** stachyose |
+ | * smiles: | ||
+ | ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4)) | ||
+ | * inchi-key: | ||
+ | ** uqziybxshagnoe-xnsrjbnmsa-n | ||
+ | * molecular-weight: | ||
+ | ** 666.583 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.67-RXN]] |
+ | * [[RXN-11501]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.4.1.67-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=stachyose}} |
+ | {{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}} | ||
+ | {{#set: molecular-weight=666.583}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-170
- common-name:
- stachyose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
- inchi-key:
- uqziybxshagnoe-xnsrjbnmsa-n
- molecular-weight:
- 666.583