Difference between revisions of "1-Alkyl-2-acyl-glycerol-3-phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Branched-chain-2-keto-acid-deH-P == * common-name: ** a phosphorylated branched-chain 2-keto acid dehydrogenase == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * smiles: ** cc(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite C4 == |
* common-name: | * common-name: | ||
− | ** | + | ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** sulooaflxmqjsf-ogdyfqgpsa-k | ||
+ | * molecular-weight: | ||
+ | ** 1670.034 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-8975]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8975]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}} |
+ | {{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}} | ||
+ | {{#set: molecular-weight=1670.034}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite C4
- common-name:
- undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
- inchi-key:
- sulooaflxmqjsf-ogdyfqgpsa-k
- molecular-weight:
- 1670.034