Difference between revisions of "1-Alkyl-2-acyl-glycerol-3-phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...") |
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the com...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate == |
* common-name: | * common-name: | ||
− | ** 1- | + | ** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17730]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17729]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=1- | + | {{#set: common-name=a 2-acyl-1-alkyl-sn-glycerol 3-phosphate}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate
- common-name:
- a 2-acyl-1-alkyl-sn-glycerol 3-phosphate