Difference between revisions of "1-Alkyl-2-acyl-glycerol-P-Etn"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20680 == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)...")
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol-P-Etn == * common-name: ** a plasmanylethalomine == Reaction(s) known to consume the compound == == Reaction(s) k...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-20680 ==
+
== Metabolite 1-Alkyl-2-acyl-glycerol-P-Etn ==
 
* common-name:
 
* common-name:
−
** diadinoxanthin
+
** a plasmanylethalomine
−
* smiles:
 
−
** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
 
−
* inchi-key:
 
−
** oghzcsinimwcsb-ghiqlmqgsa-n
 
−
* molecular-weight:
 
−
** 582.865
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-19200]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-19202]]
+
* [[RXN-17731]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=diadinoxanthin}}
+
{{#set: common-name=a plasmanylethalomine}}
−
{{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}}
 
−
{{#set: molecular-weight=582.865}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 1-Alkyl-2-acyl-glycerol-P-Etn

  • common-name:
    • a plasmanylethalomine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-Alkyl-2-acyl-glycerol-P-Etn&oldid=137387"