Difference between revisions of "1-Alkyl-2-acyl-glycerol-P-Etn"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHITOBIOSE == * common-name: ** n,n'-diacetylchitobiose == Reaction(s) known to consume the compound == * RXN-12625 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-20680 == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-20680 == |
* common-name: | * common-name: | ||
| − | ** n | + | ** diadinoxanthin |
| + | * smiles: | ||
| + | ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3) | ||
| + | * inchi-key: | ||
| + | ** oghzcsinimwcsb-ghiqlmqgsa-n | ||
| + | * molecular-weight: | ||
| + | ** 582.865 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-19200]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-19202]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=n | + | {{#set: common-name=diadinoxanthin}} |
| + | {{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}} | ||
| + | {{#set: molecular-weight=582.865}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-20680
- common-name:
- diadinoxanthin
- smiles:
- cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
- inchi-key:
- oghzcsinimwcsb-ghiqlmqgsa-n
- molecular-weight:
- 582.865
