Difference between revisions of "1-Alkyl-glycerol-3-phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11975 == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate * smiles: ** cc(=o)nc2(c(oc...")
(Created page with "Category:metabolite == Metabolite 1-Alkyl-glycerol-3-phosphate == * common-name: ** a 1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * R...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11975 ==
+
== Metabolite 1-Alkyl-glycerol-3-phosphate ==
 
* common-name:
 
* common-name:
−
** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
+
** a 1-alkyl-sn-glycerol 3-phosphate
−
* smiles:
 
−
** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
 
−
* inchi-key:
 
−
** chttvmdqgbocme-dnswdbfxsa-l
 
−
* molecular-weight:
 
−
** 461.316
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17729]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-6501]]
+
* [[RXN-17728]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}}
+
{{#set: common-name=a 1-alkyl-sn-glycerol 3-phosphate}}
−
{{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}}
 
−
{{#set: molecular-weight=461.316}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 1-Alkyl-glycerol-3-phosphate

  • common-name:
    • a 1-alkyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-Alkyl-glycerol-3-phosphate&oldid=138062"