Difference between revisions of "1-Alkyl-glycerol-3-phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11975 == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate * smiles: ** cc(=o)nc2(c(oc...")
(Created page with "Category:metabolite == Metabolite CPD-6741 == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles: ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11975 ==
+
== Metabolite CPD-6741 ==
 
* common-name:
 
* common-name:
** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
+
** d-myo-inositol (1,2,3,5,6) pentakisphosphate
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
+
** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** chttvmdqgbocme-dnswdbfxsa-l
+
** ctpqaxvnygzuaj-uotptpdrsa-d
 
* molecular-weight:
 
* molecular-weight:
** 461.316
+
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6501]]
+
* [[RXN-7241]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}}
+
{{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}}
{{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}}
+
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}}
{{#set: molecular-weight=461.316}}
+
{{#set: molecular-weight=569.977}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-6741

  • common-name:
    • d-myo-inositol (1,2,3,5,6) pentakisphosphate
  • smiles:
    • c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-uotptpdrsa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality