Difference between revisions of "1-Alkyl-sn-glycero-3-phosphocholines"

Latest revision as of 11:12, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-6972 ==
+== Metabolite 1-Alkyl-sn-glycero-3-phosphocholines ==
 * common-name:
-** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa
+** a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine
-* smiles:
-** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o
-* inchi-key:
-** kvaqapqxoxtrae-uhfffaoysa-i
-* molecular-weight:
-** 966.676
 == Reaction(s) known to consume the compound ==
-* [[NAPHTHOATE-SYN-RXN]]
+* [[2.3.1.149-RXN]]
+* [[2.3.1.67-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[NPHS]]
+* [[2.3.1.149-RXN]]
-* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
+* [[2.3.1.67-RXN]]
-* [[RXN-7614]]
+* [[3.1.1.47-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-(2'-carboxyphenyl)-4-oxobutyryl-coa}}
+{{#set: common-name=a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine}}
-{{#set: inchi-key=inchikey=kvaqapqxoxtrae-uhfffaoysa-i}}
-{{#set: molecular-weight=966.676}}