Difference between revisions of "1-Alpha-Linolenoyl-L-Phosphatidate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == * common-name: ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to con...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == |
* common-name: | * common-name: | ||
| − | ** & | + | ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16071]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate
- common-name:
- a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate
