Difference between revisions of "1-Alpha-Linolenoyl-L-Phosphatidate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] == * direction: ** reversible * common-name: ** glyceraldehyde-3-pho...")
(Created page with "Category:metabolite == Metabolite CPD-13534 == * common-name: ** 3-oxopentanoyl-coa * smiles: ** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] ==
+
== Metabolite CPD-13534 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** glyceraldehyde-3-phosphate dehydrogenase (nad(p)+) (phosphorylating)
+
** 3-oxopentanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.2.1.59 ec-1.2.1.59]
+
** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[GAP]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[DPG]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c]
+
** wioqnwtzboqteu-zmhdxicwsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ00348]]
+
** 861.604
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-12561]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[RXN-12560]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== External links  ==
+
{{#set: common-name=3-oxopentanoyl-coa}}
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}}
** [http://www.genome.jp/dbget-bin/www_bget?R01063 R01063]
+
{{#set: molecular-weight=861.604}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10299 10299]
 
{{#set: direction=reversible}}
 
{{#set: common-name=glyceraldehyde-3-phosphate dehydrogenase (nad(p)+) (phosphorylating)}}
 
{{#set: ec-number=ec-1.2.1.59}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-13534

  • common-name:
    • 3-oxopentanoyl-coa
  • smiles:
    • ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • wioqnwtzboqteu-zmhdxicwsa-j
  • molecular-weight:
    • 861.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality