Difference between revisions of "1-CARBOXYVINYL-CARBOXYPHOSPHONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15614 == * transcription-direction: ** positive * right-end-position: ** 117546 * left-end-position: ** 99020 * centisome-position: ** 33.730984...")
(Created page with "Category:metabolite == Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE == * common-name: ** 1-carboxyvinyl carboxyphosphonate * smiles: ** c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15614 ==
+
== Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE ==
* transcription-direction:
+
* common-name:
** positive
+
** 1-carboxyvinyl carboxyphosphonate
* right-end-position:
+
* smiles:
** 117546
+
** c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]
* left-end-position:
+
* inchi-key:
** 99020
+
** lpufgtsgsicqbx-uhfffaoysa-k
* centisome-position:
+
* molecular-weight:
** 33.730984   
+
** 193.029
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.8.23-RXN]]
== Reaction(s) associated ==
+
* [[RXN-10827]]
* [[RXN-16889]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[2.7.8.23-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-16891]]
+
{{#set: common-name=1-carboxyvinyl carboxyphosphonate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=lpufgtsgsicqbx-uhfffaoysa-k}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=193.029}}
* [[RXN-17121]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=117546}}
 
{{#set: left-end-position=99020}}
 
{{#set: centisome-position=33.730984    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE

  • common-name:
    • 1-carboxyvinyl carboxyphosphonate
  • smiles:
    • c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]
  • inchi-key:
    • lpufgtsgsicqbx-uhfffaoysa-k
  • molecular-weight:
    • 193.029

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality