Difference between revisions of "1-KETO-2-METHYLVALERATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXY-BUTANONE-P == * common-name: ** 1-deoxy-l-glycero-tetrulose 4-phosphate * smiles: ** cc(=o)c(o)cop(=o)([o-])[o-] * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite 1-KETO-2-METHYLVALERATE == * common-name: ** (r)-2,3-dihydroxy-3-methylpentanoate * smiles: ** ccc(o)(c)c(c([o-])=o)o * inchi-key: ** pdg...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-KETO-2-METHYLVALERATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-2,3-dihydroxy-3-methylpentanoate |
* smiles: | * smiles: | ||
− | ** | + | ** ccc(o)(c)c(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pdgxjdxvgmhuir-ujursfkzsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 147.15 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIHYDROXYMETVALDEHYDRAT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACETOOHBUTREDUCTOISOM-RXN]] |
+ | * [[KARI_LPAREN_23dhmp_RPAREN_]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-2,3-dihydroxy-3-methylpentanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pdgxjdxvgmhuir-ujursfkzsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.15}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 1-KETO-2-METHYLVALERATE
- common-name:
- (r)-2,3-dihydroxy-3-methylpentanoate
- smiles:
- ccc(o)(c)c(c([o-])=o)o
- inchi-key:
- pdgxjdxvgmhuir-ujursfkzsa-m
- molecular-weight:
- 147.15