Difference between revisions of "1-L-MYO-INOSITOL-1-P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01956 == * transcription-direction: ** positive * right-end-position: ** 20368 * left-end-position: ** 14814 * centisome-position: ** 10.326728...") |
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 1-L-MYO-INOSITOL-1-P == |
− | * | + | * common-name: |
− | ** | + | ** 1d-myo-inositol 3-monophosphate |
− | * | + | * smiles: |
− | ** | + | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** inapmgsxuvuwaf-ptqmnwpwsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 258.121 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] | |
− | == Reaction(s) | + | * [[RXN-6501]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] | |
− | + | * [[RXN-10960]] | |
− | + | * [[RXN66-579]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1d-myo-inositol 3-monophosphate}} | |
− | + | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}} | |
− | + | {{#set: molecular-weight=258.121}} | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 1-L-MYO-INOSITOL-1-P
- common-name:
- 1d-myo-inositol 3-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-ptqmnwpwsa-l
- molecular-weight:
- 258.121