Difference between revisions of "1-L-MYO-INOSITOL-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15075 == * transcription-direction: ** negative * right-end-position: ** 277459 * left-end-position: ** 264854 * centisome-position: ** 87.461365...")
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15075 ==
+
== Metabolite 1-L-MYO-INOSITOL-1-P ==
* transcription-direction:
+
* common-name:
** negative
+
** 1d-myo-inositol 3-monophosphate
* right-end-position:
+
* smiles:
** 277459
+
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
* left-end-position:
+
* inchi-key:
** 264854
+
** inapmgsxuvuwaf-ptqmnwpwsa-l
* centisome-position:
+
* molecular-weight:
** 87.461365   
+
** 258.121
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
== Reaction(s) associated ==
+
* [[RXN-6501]]
* [[RXN-13398]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10960]]
** Category: [[orthology]]
+
* [[RXN66-579]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-7676]]
+
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=258.121}}
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-7677]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5068]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=277459}}
 
{{#set: left-end-position=264854}}
 
{{#set: centisome-position=87.461365    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 1-L-MYO-INOSITOL-1-P

  • common-name:
    • 1d-myo-inositol 3-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-ptqmnwpwsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality