Difference between revisions of "1-L-MYO-INOSITOL-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(scc...")
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-18493 ==
+
== Metabolite 1-L-MYO-INOSITOL-1-P ==
 
* common-name:
 
* common-name:
−
** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** 1d-myo-inositol 3-monophosphate
 
* smiles:
 
* smiles:
−
** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
−
** nneppynerzejee-vugypbmhsa-j
+
** inapmgsxuvuwaf-ptqmnwpwsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 1120.05
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 +
* [[RXN-6501]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17114]]
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[RXN-10960]]
 +
* [[RXN66-579]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
−
{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
−
{{#set: molecular-weight=1120.05}}
+
{{#set: molecular-weight=258.121}}

Latest revision as of 11:14, 18 March 2021

Metabolite 1-L-MYO-INOSITOL-1-P

  • common-name:
    • 1d-myo-inositol 3-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-ptqmnwpwsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-L-MYO-INOSITOL-1-P&oldid=138248"