Difference between revisions of "1-L-MYO-INOSITOL-1-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ENZYME-S-SULFANYLCYSTEINE == * common-name: ** a [protein]-s-sulfanyl-l-cysteine == Reaction(s) known to consume the compound == * RXN-...") |
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-L-MYO-INOSITOL-1-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1d-myo-inositol 3-monophosphate |
| + | * smiles: | ||
| + | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** inapmgsxuvuwaf-ptqmnwpwsa-l | ||
| + | * molecular-weight: | ||
| + | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] |
| + | * [[RXN-6501]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] | ||
| + | * [[RXN-10960]] | ||
| + | * [[RXN66-579]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 3-monophosphate}} |
| + | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}} | ||
| + | {{#set: molecular-weight=258.121}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 1-L-MYO-INOSITOL-1-P
- common-name:
- 1d-myo-inositol 3-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-ptqmnwpwsa-l
- molecular-weight:
- 258.121
