Difference between revisions of "1-L-MYO-INOSITOL-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(scc...")
(Created page with "Category:metabolite == Metabolite ENZYME-S-SULFANYLCYSTEINE == * common-name: ** a [protein]-s-sulfanyl-l-cysteine == Reaction(s) known to consume the compound == * RXN-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-18493 ==
+
== Metabolite ENZYME-S-SULFANYLCYSTEINE ==
 
* common-name:
 
* common-name:
−
** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** a [protein]-s-sulfanyl-l-cysteine
−
* smiles:
 
−
** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
−
* inchi-key:
 
−
** nneppynerzejee-vugypbmhsa-j
 
−
* molecular-weight:
 
−
** 1120.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16820]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17114]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=a [protein]-s-sulfanyl-l-cysteine}}
−
{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}
 
−
{{#set: molecular-weight=1120.05}}
 

Revision as of 14:57, 5 January 2021

Metabolite ENZYME-S-SULFANYLCYSTEINE

  • common-name:
    • a [protein]-s-sulfanyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-s-sulfanyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-L-MYO-INOSITOL-1-P&oldid=60090"