Difference between revisions of "1-Linoleoyl-2-acyl-glycerolipids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUCROSE == * common-name: ** sucrose * smiles: ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o * inchi-key: ** czmrcdwagmrecn-ugdnzrgbsa...")
(Created page with "Category:metabolite == Metabolite 1-Linoleoyl-2-acyl-glycerolipids == * common-name: ** a 1-linoleoyl 2-acyl-[glycerolipid] == Reaction(s) known to consume the compound ==...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUCROSE ==
+
== Metabolite 1-Linoleoyl-2-acyl-glycerolipids ==
 
* common-name:
 
* common-name:
** sucrose
+
** a 1-linoleoyl 2-acyl-[glycerolipid]
* smiles:
 
** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
 
* inchi-key:
 
** czmrcdwagmrecn-ugdnzrgbsa-n
 
* molecular-weight:
 
** 342.299
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.82-RXN]]
+
* [[RXN-16994]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11502]]
+
* [[RXN-16994]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sucrose}}
+
{{#set: common-name=a 1-linoleoyl 2-acyl-[glycerolipid]}}
{{#set: inchi-key=inchikey=czmrcdwagmrecn-ugdnzrgbsa-n}}
 
{{#set: molecular-weight=342.299}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 1-Linoleoyl-2-acyl-glycerolipids

  • common-name:
    • a 1-linoleoyl 2-acyl-[glycerolipid]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 1-linoleoyl 2-acyl-[glycerolipid" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.