Difference between revisions of "1-O-SINAPOYL-BETA-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13168 RXN-13168] == * direction: ** left-to-right * common-name: ** tobramycin 6''-carbamoyltra...")
(Created page with "Category:metabolite == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == * common-name: ** 1-o-sinapoyl-β-d-glucose * smiles: ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13168 RXN-13168] ==
+
== Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** tobramycin 6''-carbamoyltransferase
+
** 1-o-sinapoyl-β-d-glucose
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPD-14154]][c] '''+''' 1 [[CPD-15424]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-14158]][c] '''+''' 1 [[PROTON]][c]
+
** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ02092]]
+
** xrkbrpftfkkhef-dgdbgzaxsa-n
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 386.355
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[2.3.1.91-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
* RHEA:
+
{{#set: common-name=1-o-sinapoyl-β-d-glucose}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=36384 36384]
+
{{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=386.355}}
−
{{#set: common-name=tobramycin 6''-carbamoyltransferase}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE

  • common-name:
    • 1-o-sinapoyl-β-d-glucose
  • smiles:
    • coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
  • inchi-key:
    • xrkbrpftfkkhef-dgdbgzaxsa-n
  • molecular-weight:
    • 386.355

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-O-SINAPOYL-BETA-D-GLUCOSE&oldid=138756"