Difference between revisions of "1-PALMITOYLGLYCEROL-3-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] * inchi-key: ** ljqlqc...") |
(Created page with "Category:metabolite == Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE == * common-name: ** 1-palmitoylglycerol 3-phosphate * smiles: ** cccccccccccccccc(=o)occ(o)cop(=o)([o-])...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** 3 | + | ** 1-palmitoylglycerol 3-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yndykprnfwppfu-gosisdbhsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 408.471 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17008]] |
| − | * [[ | + | * [[RXN-17010]] |
| − | * [[ | + | * [[RXN-17012]] |
| − | * [[ | + | * [[RXN-17014]] |
| − | * [[ | + | * [[RXN-17023]] |
| − | * [[ | + | * [[RXN-17024]] |
| + | * [[RXN0-6705]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17018]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3 | + | {{#set: common-name=1-palmitoylglycerol 3-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yndykprnfwppfu-gosisdbhsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=408.471}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE
- common-name:
- 1-palmitoylglycerol 3-phosphate
- smiles:
- cccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
- inchi-key:
- yndykprnfwppfu-gosisdbhsa-l
- molecular-weight:
- 408.471
