Difference between revisions of "1-PALMITOYLGLYCEROL-3-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9958 == * common-name: ** ubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite Ribonucleosides == * common-name: ** a ribonucleoside == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9958 ==
+
== Metabolite Ribonucleosides ==
 
* common-name:
 
* common-name:
** ubiquinol-10
+
** a ribonucleoside
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
** qntnkslofhefpk-uptccgcdsa-n
 
* molecular-weight:
 
** 865.373
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9237]]
+
* [[5-NUCLEOTID-RXN]]
 +
* [[RXN-17948]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-10}}
+
{{#set: common-name=a ribonucleoside}}
{{#set: inchi-key=inchikey=qntnkslofhefpk-uptccgcdsa-n}}
 
{{#set: molecular-weight=865.373}}
 

Revision as of 13:11, 14 January 2021

Metabolite Ribonucleosides

  • common-name:
    • a ribonucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality