Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...")
(Created page with "Category:metabolite == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 3,4-bisphosphate == Reaction(s) known to co...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 3-7-DIMETHYLXANTHINE ==
+
== Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH ==
 
* common-name:
 
* common-name:
−
** theobromine
+
** a 1-phosphatidyl-1d-myo-inositol 3,4-bisphosphate
−
* smiles:
 
−
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 
−
* inchi-key:
 
−
** yapqbxqyljrxsa-uhfffaoysa-n
 
−
* molecular-weight:
 
−
** 180.166
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11519]]
+
* [[3.1.3.66-RXN]]
 +
* [[RXN-10947]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10036]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=theobromine}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3,4-bisphosphate}}
−
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}
 
−
{{#set: molecular-weight=180.166}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH

  • common-name:
    • a 1-phosphatidyl-1d-myo-inositol 3,4-bisphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH&oldid=136984"