Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-321 == * common-name: ** 3-aci-nitropropanoate * smiles: ** c(cc([o-])=o)=[n+]([o-])[o-] * inchi-key: ** kxxxivrxvxkxpa-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate == Reaction(s) known to cons...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10958]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.7.1.150-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH
- common-name:
- 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate