Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])n)=o)(=o)[o-] * inchi-key: ** arbhxjxxvvhmet-uhfffa...")
(Created page with "Category:metabolite == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 5-phosphate == Reaction(s) known to consum...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-824 ==
+
== Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA ==
 
* common-name:
 
* common-name:
−
** 5-guanidino-2-oxopentanoate
+
** a 1-phosphatidyl-1d-myo-inositol 5-phosphate
−
* smiles:
 
−
** c(c(cccnc(=[n+])n)=o)(=o)[o-]
 
−
* inchi-key:
 
−
** arbhxjxxvvhmet-uhfffaoysa-n
 
−
* molecular-weight:
 
−
** 173.171
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ARG-OXIDATION-RXN]]
+
* [[RXN-10958]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5-guanidino-2-oxopentanoate}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 5-phosphate}}
−
{{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}}
 
−
{{#set: molecular-weight=173.171}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA

  • common-name:
    • a 1-phosphatidyl-1d-myo-inositol 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA&oldid=139385"