Difference between revisions of "1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID"

Revision as of 08:28, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite PROPIONYL-COA ==
+== Metabolite INOSITOL-1-4-BISPHOSPHATE ==
 * common-name:
-** propanoyl-coa
+** d-myo-inositol (1,4)-bisphosphate
 * smiles:
-** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
 * inchi-key:
-** qaqrevbbadehpa-iexphmlfsa-j
+** pelzspzcxgtumr-rtphhqfdsa-j
 * molecular-weight:
-** 819.566
+** 336.085
 == Reaction(s) known to consume the compound ==
-* [[METHYLACETOACETYLCOATHIOL-RXN]]
+* [[3.1.3.57-RXN]]
-* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
-* [[PPCOAOm]]
-* [[PROPIONYL-COA-CARBOXY-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[1.2.1.27-RXN]]
+* [[3.1.3.56-RXN]]
-* [[2.3.1.176-RXN]]
+* [[RXN-13334]]
-* [[ACCAT]]
-* [[METHYLACETOACETYLCOATHIOL-RXN]]
-* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
-* [[PPCOAOm]]
-* [[PROPIONYL-COA-CARBOXY-RXN]]
-* [[RXN-11213]]
-* [[RXN-12561]]
-* [[RXN-7790]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=propanoyl-coa}}
+{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
-{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
+{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
-{{#set: molecular-weight=819.566}}
+{{#set: molecular-weight=336.085}}