Difference between revisions of "1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c...")
(Created page with "Category:metabolite == Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID == * common-name: ** a 1-organyl-2-lyso-sn-glycero-3-phospholipid == Reaction(s) known to consum...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROPIONYL-COA ==
+
== Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID ==
 
* common-name:
 
* common-name:
** propanoyl-coa
+
** a 1-organyl-2-lyso-sn-glycero-3-phospholipid
* smiles:
 
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** qaqrevbbadehpa-iexphmlfsa-j
 
* molecular-weight:
 
** 819.566
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* [[2.3.1.149-RXN]]
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 
* [[PPCOAOm]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.27-RXN]]
+
* [[2.3.1.149-RXN]]
* [[2.3.1.176-RXN]]
 
* [[ACCAT]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 
* [[PPCOAOm]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[RXN-11213]]
 
* [[RXN-12561]]
 
* [[RXN-7790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=propanoyl-coa}}
+
{{#set: common-name=a 1-organyl-2-lyso-sn-glycero-3-phospholipid}}
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
 
{{#set: molecular-weight=819.566}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID

  • common-name:
    • a 1-organyl-2-lyso-sn-glycero-3-phospholipid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality