Difference between revisions of "1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,4)-bisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([...")
(Created page with "Category:metabolite == Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID == * common-name: ** a 1-organyl-2-lyso-sn-glycero-3-phospholipid == Reaction(s) known to consum...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite INOSITOL-1-4-BISPHOSPHATE ==
+
== Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID ==
 
* common-name:
 
* common-name:
−
** d-myo-inositol (1,4)-bisphosphate
+
** a 1-organyl-2-lyso-sn-glycero-3-phospholipid
−
* smiles:
 
−
** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
 
−
* inchi-key:
 
−
** pelzspzcxgtumr-rtphhqfdsa-j
 
−
* molecular-weight:
 
−
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[3.1.3.57-RXN]]
+
* [[2.3.1.149-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.1.3.56-RXN]]
+
* [[2.3.1.149-RXN]]
−
* [[RXN-13334]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
+
{{#set: common-name=a 1-organyl-2-lyso-sn-glycero-3-phospholipid}}
−
{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
 
−
{{#set: molecular-weight=336.085}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID

  • common-name:
    • a 1-organyl-2-lyso-sn-glycero-3-phospholipid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID&oldid=138335"