Difference between revisions of "1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01009 == * transcription-direction: ** positive * right-end-position: ** 81048 * left-end-position: ** 71004 * centisome-position: ** 44.793236...")
(Created page with "Category:metabolite == Metabolite ENOL-OXALOACETATE == * common-name: ** enol-oxaloacetate * smiles: ** c([o-])(=o)c(o)=cc(=o)[o-] * inchi-key: ** uwyvpfmhmjibhe-uphrsurjs...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01009 ==
+
== Metabolite ENOL-OXALOACETATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** enol-oxaloacetate
−
* right-end-position:
+
* smiles:
−
** 81048
+
** c([o-])(=o)c(o)=cc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 71004
+
** uwyvpfmhmjibhe-uphrsurjsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 44.793236   
+
** 130.057
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[OXALOACETATE-TAUTOMERASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.7.10.1-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=enol-oxaloacetate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=uwyvpfmhmjibhe-uphrsurjsa-l}}
−
* [[2.7.12.1-RXN]]
+
{{#set: molecular-weight=130.057}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14906]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=81048}}
 
−
{{#set: left-end-position=71004}}
 
−
{{#set: centisome-position=44.793236    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 

Revision as of 20:34, 18 December 2020

Metabolite ENOL-OXALOACETATE

  • common-name:
    • enol-oxaloacetate
  • smiles:
    • c([o-])(=o)c(o)=cc(=o)[o-]
  • inchi-key:
    • uwyvpfmhmjibhe-uphrsurjsa-l
  • molecular-weight:
    • 130.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID&oldid=47151"