Difference between revisions of "1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite 3-KETOACYL-COA == * common-name: ** a 3-oxoacyl-coa == Reaction(s) known to consume the compound == * KETOACYLCOATHIOL-RXN * RXN-13...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17401 ==
+
== Metabolite 3-KETOACYL-COA ==
 
* common-name:
 
* common-name:
** 3-oxo-auricoloyl-coa
+
** a 3-oxoacyl-coa
* smiles:
 
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** fgcwebktqlbclr-jrszcninsa-j
 
* molecular-weight:
 
** 1083.973
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16154]]
+
* [[KETOACYLCOATHIOL-RXN]]
 +
* [[RXN-13279]]
 +
* [[RXN-16133]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16153]]
+
* [[OHACYL-COA-DEHYDROG-RXN]]
 +
* [[RXN-13279]]
 +
* [[RXN-16133]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-auricoloyl-coa}}
+
{{#set: common-name=a 3-oxoacyl-coa}}
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
 
{{#set: molecular-weight=1083.973}}
 

Revision as of 15:28, 5 January 2021

Metabolite 3-KETOACYL-COA

  • common-name:
    • a 3-oxoacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality