Difference between revisions of "1-alpha-Linolenoyl-2-acyl-glycerolipids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite GLYCYL-PEPTIDE == * smiles: ** c(c(nc(c(o)=o)[r])=o)n * common-name: ** glycyl-peptide == Reaction(s) known to consume the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15637 ==
+
== Metabolite GLYCYL-PEPTIDE ==
 +
* smiles:
 +
** c(c(nc(c(o)=o)[r])=o)n
 
* common-name:
 
* common-name:
** 6-cis-tridecenoyl-coa
+
** glycyl-peptide
* smiles:
 
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** uuivzebypbpkll-dxazuofzsa-j
 
* molecular-weight:
 
** 957.819
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14771]]
+
* [[2.3.1.97-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis-tridecenoyl-coa}}
+
{{#set: common-name=glycyl-peptide}}
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
 
{{#set: molecular-weight=957.819}}
 

Revision as of 15:24, 5 January 2021

Metabolite GLYCYL-PEPTIDE

  • smiles:
    • c(c(nc(c(o)=o)[r])=o)n
  • common-name:
    • glycyl-peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality