Difference between revisions of "1-gamma-Linolenoyl-L-Phosphatidate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-K+ TransportSeed-K+] == * direction: ** left-to-right == Reaction formula == * 1.0 ...")
(Created page with "Category:metabolite == Metabolite CPD-17312 == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-K+ TransportSeed-K+] ==
+
== Metabolite CPD-17312 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** docosahexaenoyl-coa
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[K+]][e] '''=>''' 1.0 [[K+]][c]
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
== Pathway(s) ==
+
** menfzxmqsyyvrk-crcgjgbysa-j
−
== Reconstruction information  ==
+
* molecular-weight:
−
* category: [[manual]]; source: [[import_from_medium]]; tool: [[curation]]; comment: added to manage seeds from extracellular to cytosol compartment
+
** 1073.981
−
== External links  ==
+
== Reaction(s) known to consume the compound ==
−
{{#set: direction=left-to-right}}
+
* [[RXN-16063]]
−
{{#set: nb gene associated=0}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: nb pathway associated=0}}
+
* [[RXN-16063]]
−
{{#set: reconstruction category=manual}}
+
* [[RXN-16137]]
−
{{#set: reconstruction tool=curation}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
+
{{#set: common-name=docosahexaenoyl-coa}}
−
{{#set: reconstruction source=import_from_medium}}
+
{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
 +
{{#set: molecular-weight=1073.981}}

Revision as of 20:37, 18 December 2020

Metabolite CPD-17312

  • common-name:
    • docosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • menfzxmqsyyvrk-crcgjgbysa-j
  • molecular-weight:
    • 1073.981

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-gamma-Linolenoyl-L-Phosphatidate&oldid=48347"