Difference between revisions of "1-stearidonoyl-L-Phosphatidate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINE == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=[n+])n * inchi-key: ** fsbigdsbmbyopn-vkhmyheasa-o * m...") |
(Created page with "Category:metabolite == Metabolite 1-stearidonoyl-L-Phosphatidate == * common-name: ** a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the c...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-stearidonoyl-L-Phosphatidate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16070]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 1-stearidonoyl-L-Phosphatidate
- common-name:
- a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate
